C22H26N5O4+ — CID 9436801
(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9436801) has the molecular formula C22H26N5O4+ and a molecular weight of 424.48 g/mol. Its IUPAC name is (3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9436801 |
| Molecular Formula | C22H26N5O4+ |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)methyl-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)Cc2c(C)nn(-c3ccccc3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N5O4/c1-15-19(16(2)26(24-15)17-8-6-5-7-9-17)13-25(3)14-22(28)23-20-11-10-18(31-4)12-21(20)27(29)30/h5-12H,13-14H2,1-4H3,(H,23,28)/p+1 |
| InChIKey | AGPWYCXSLCTWKU-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|