C20H24N3O5+ — CID 9168237
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 9168237) has the molecular formula C20H24N3O5+ and a molecular weight of 386.43 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9168237 |
| Molecular Formula | C20H24N3O5+ |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH+](C)CC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-4-11-28-16-7-5-15(6-8-16)13-22(2)14-20(24)21-18-10-9-17(27-3)12-19(18)23(25)26/h4-10,12H,1,11,13-14H2,2-3H3,(H,21,24)/p+1 |
| InChIKey | KEGZHODGJCMIRU-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|