C19H21ClFN2O2+ — CID 9168147
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 9168147) has the molecular formula C19H21ClFN2O2+ and a molecular weight of 363.84 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9168147 |
| Molecular Formula | C19H21ClFN2O2+ |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH+](C)CC(=O)Nc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C19H20ClFN2O2/c1-3-10-25-16-7-4-14(5-8-16)12-23(2)13-19(24)22-18-9-6-15(20)11-17(18)21/h3-9,11H,1,10,12-13H2,2H3,(H,22,24)/p+1 |
| InChIKey | XREMXVSETRKWTN-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|