C15H22ClFN3O2+ — CID 8766648
[2-(tert-butylamino)-2-oxoethyl]-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8766648) has the molecular formula C15H22ClFN3O2+ and a molecular weight of 330.81 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8766648 |
| Molecular Formula | C15H22ClFN3O2+ |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(4-chloro-2-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Cl)cc1F)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H21ClFN3O2/c1-15(2,3)19-14(22)9-20(4)8-13(21)18-12-6-5-10(16)7-11(12)17/h5-7H,8-9H2,1-4H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | LLDLHGBBFOCVJS-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |