C16H26N3O2+ — CID 8756671
[2-(tert-butylamino)-2-oxoethyl]-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium (PubChem CID 8756671) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8756671 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-(2-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccccc1NC(=O)C[NH+](C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H25N3O2/c1-12-8-6-7-9-13(12)17-14(20)10-19(5)11-15(21)18-16(2,3)4/h6-9H,10-11H2,1-5H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | LLLVOHGNLJYFGR-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |