C21H28N5O2+ — CID 8766744
[2-(tert-butylamino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium (PubChem CID 8766744) has the molecular formula C21H28N5O2+ and a molecular weight of 382.49 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8766744 |
| Molecular Formula | C21H28N5O2+ |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenyldiazenylanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(/N=N/c2ccccc2)cc1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H27N5O2/c1-21(2,3)23-20(28)15-26(4)14-19(27)22-16-10-12-18(13-11-16)25-24-17-8-6-5-7-9-17/h5-13H,14-15H2,1-4H3,(H,22,27)(H,23,28)/p+1/b25-24+ |
| InChIKey | HOPIYCKHICXOAK-OCOZRVBESA-O |
| XLogP | 2.47 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|