C16H23N4O2+ — CID 8756761
[2-(tert-butylamino)-2-oxoethyl]-[2-(3-cyanoanilino)-2-oxoethyl]-methylazanium (PubChem CID 8756761) has the molecular formula C16H23N4O2+ and a molecular weight of 303.39 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(3-cyanoanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(3-cyanoanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8756761 |
| Molecular Formula | C16H23N4O2+ |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(3-cyanoanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(C#N)c1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H22N4O2/c1-16(2,3)19-15(22)11-20(4)10-14(21)18-13-7-5-6-12(8-13)9-17/h5-8H,10-11H2,1-4H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | QNYGWGQCOLYWDA-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |