C20H24N3O+ — CID 9028568
[2-(3-cyanoanilino)-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium (PubChem CID 9028568) has the molecular formula C20H24N3O+ and a molecular weight of 322.43 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9028568 |
| Molecular Formula | C20H24N3O+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl]-methyl-[(4-propan-2-ylphenyl)methyl]azanium |
| SMILES | CC(C)c1ccc(C[NH+](C)CC(=O)Nc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-15(2)18-9-7-16(8-10-18)13-23(3)14-20(24)22-19-6-4-5-17(11-19)12-21/h4-11,15H,13-14H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | ZOPQZQSWNZUHSU-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |