C17H17ClN3O+ — CID 9166886
[2-(4-chloroanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium (PubChem CID 9166886) has the molecular formula C17H17ClN3O+ and a molecular weight of 314.80 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9166886 |
| Molecular Formula | C17H17ClN3O+ |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl]-[(4-cyanophenyl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Cl)cc1)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16ClN3O/c1-21(11-14-4-2-13(10-19)3-5-14)12-17(22)20-16-8-6-15(18)7-9-16/h2-9H,11-12H2,1H3,(H,20,22)/p+1 |
| InChIKey | NWXXELTYLVGQDO-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |