C17H26N3O3+ — CID 8766689
[2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-methylazanium (PubChem CID 8766689) has the molecular formula C17H26N3O3+ and a molecular weight of 320.41 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8766689 |
| Molecular Formula | C17H26N3O3+ |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-methylazanium |
| SMILES | CC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N3O3/c1-12(21)13-6-8-14(9-7-13)18-15(22)10-20(5)11-16(23)19-17(2,3)4/h6-9H,10-11H2,1-5H3,(H,18,22)(H,19,23)/p+1 |
| InChIKey | HEBSBJYASKVXGT-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |