C20H24N3O3+ — CID 8588768
[2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 8588768) has the molecular formula C20H24N3O3+ and a molecular weight of 354.43 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8588768 |
| Molecular Formula | C20H24N3O3+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-7-9-17(10-8-14)21-19(25)12-23(3)13-20(26)22-18-6-4-5-16(11-18)15(2)24/h4-11H,12-13H2,1-3H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | KXWXDOWGZXQZSJ-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |