C17H20BrN2O+ — CID 9024743
[2-(3-bromoanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium (PubChem CID 9024743) has the molecular formula C17H20BrN2O+ and a molecular weight of 348.26 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9024743 |
| Molecular Formula | C17H20BrN2O+ |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl]-methyl-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)CC(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C17H19BrN2O/c1-13-6-8-14(9-7-13)11-20(2)12-17(21)19-16-5-3-4-15(18)10-16/h3-10H,11-12H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | DVTRUCPMVNXUQB-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |