C12H17N2O4+ — CID 58024766
[2-(4-carboxyanilino)-2-oxoethyl]-(2-hydroxyethyl)-methylazanium (PubChem CID 58024766) has the molecular formula C12H17N2O4+ and a molecular weight of 253.28 g/mol. Its IUPAC name is [2-(4-carboxyanilino)-2-oxoethyl]-(2-hydroxyethyl)-methylazanium.
| Compound Name | [2-(4-carboxyanilino)-2-oxoethyl]-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 58024766 |
| Molecular Formula | C12H17N2O4+ |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [2-(4-carboxyanilino)-2-oxoethyl]-(2-hydroxyethyl)-methylazanium |
| SMILES | C[NH+](CCO)CC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-14(6-7-15)8-11(16)13-10-4-2-9(3-5-10)12(17)18/h2-5,15H,6-8H2,1H3,(H,13,16)(H,17,18)/p+1 |
| InChIKey | FHOHOKZJWXCNRC-UHFFFAOYSA-O |
| XLogP | -1.17 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |