C15H23N4O3+ — CID 8695103
[2-(dimethylamino)-2-oxoethyl]-methyl-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 8695103) has the molecular formula C15H23N4O3+ and a molecular weight of 307.37 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl]-methyl-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | [2-(dimethylamino)-2-oxoethyl]-methyl-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8695103 |
| Molecular Formula | C15H23N4O3+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl]-methyl-[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | CNC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C15H22N4O3/c1-16-15(22)11-5-7-12(8-6-11)17-13(20)9-19(4)10-14(21)18(2)3/h5-8H,9-10H2,1-4H3,(H,16,22)(H,17,20)/p+1 |
| InChIKey | SDKNKECPYFTKOJ-UHFFFAOYSA-O |
| XLogP | -1.41 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |