C13H19IN3O2+ — CID 8712032
[2-(dimethylamino)-2-oxoethyl]-[2-(4-iodoanilino)-2-oxoethyl]-methylazanium (PubChem CID 8712032) has the molecular formula C13H19IN3O2+ and a molecular weight of 376.22 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl]-[2-(4-iodoanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(dimethylamino)-2-oxoethyl]-[2-(4-iodoanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8712032 |
| Molecular Formula | C13H19IN3O2+ |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl]-[2-(4-iodoanilino)-2-oxoethyl]-methylazanium |
| SMILES | CN(C)C(=O)C[NH+](C)CC(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C13H18IN3O2/c1-16(2)13(19)9-17(3)8-12(18)15-11-6-4-10(14)5-7-11/h4-7H,8-9H2,1-3H3,(H,15,18)/p+1 |
| InChIKey | OKIQIKCBSSQJPP-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|