C10H11NO5S — CID 60693118
4-[(2-methylsulfonylacetyl)amino]benzoic acid (PubChem CID 60693118) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is 4-[(2-methylsulfonylacetyl)amino]benzoic acid.
| Compound Name | 4-[(2-methylsulfonylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 60693118 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(2-methylsulfonylacetyl)amino]benzoic acid |
| SMILES | CS(=O)(=O)CC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H11NO5S/c1-17(15,16)6-9(12)11-8-4-2-7(3-5-8)10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | NNUSFMGRLGNOHJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |