C13H15NO5S — CID 115912899
1-[4-[(2-methylsulfonylacetyl)amino]phenyl]cyclopropane-1-carboxylic acid (PubChem CID 115912899) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-[4-[(2-methylsulfonylacetyl)amino]phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[(2-methylsulfonylacetyl)amino]phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115912899 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 1-[4-[(2-methylsulfonylacetyl)amino]phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CS(=O)(=O)CC(=O)Nc1ccc(C2(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C13H15NO5S/c1-20(18,19)8-11(15)14-10-4-2-9(3-5-10)13(6-7-13)12(16)17/h2-5H,6-8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | HAIJGKVNALXOAP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |