C15H19NO5 — CID 60941573
4-[(3-carboxy-3,4-dimethylpentanoyl)amino]benzoic acid (PubChem CID 60941573) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[(3-carboxy-3,4-dimethylpentanoyl)amino]benzoic acid.
| Compound Name | 4-[(3-carboxy-3,4-dimethylpentanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 60941573 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[(3-carboxy-3,4-dimethylpentanoyl)amino]benzoic acid |
| SMILES | CC(C)C(C)(CC(=O)Nc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C15H19NO5/c1-9(2)15(3,14(20)21)8-12(17)16-11-6-4-10(5-7-11)13(18)19/h4-7,9H,8H2,1-3H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | VWAPHLDILAHECZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |