C14H18N2O3 — CID 108506817
N-(4-acetylphenyl)-N'-tert-butyloxamide (PubChem CID 108506817) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-tert-butyloxamide.
| Compound Name | N-(4-acetylphenyl)-N'-tert-butyloxamide |
|---|---|
| PubChem CID | 108506817 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(4-acetylphenyl)-N'-tert-butyloxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H18N2O3/c1-9(17)10-5-7-11(8-6-10)15-12(18)13(19)16-14(2,3)4/h5-8H,1-4H3,(H,15,18)(H,16,19) |
| InChIKey | JNXQBBUDOWQFCJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|