C20H22N2O3 — CID 108511377
N-(4-acetylphenyl)-N'-(2,6-diethylphenyl)oxamide (PubChem CID 108511377) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(2,6-diethylphenyl)oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-(2,6-diethylphenyl)oxamide |
|---|---|
| PubChem CID | 108511377 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(2,6-diethylphenyl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-14-7-6-8-15(5-2)18(14)22-20(25)19(24)21-17-11-9-16(10-12-17)13(3)23/h6-12H,4-5H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | VUUKKFHBKOEYGL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|