C24H25N3O2 — CID 108511452
N-(4-anilinophenyl)-N'-(2,6-diethylphenyl)oxamide (PubChem CID 108511452) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-(4-anilinophenyl)-N'-(2,6-diethylphenyl)oxamide.
| Compound Name | N-(4-anilinophenyl)-N'-(2,6-diethylphenyl)oxamide |
|---|---|
| PubChem CID | 108511452 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(4-anilinophenyl)-N'-(2,6-diethylphenyl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O2/c1-3-17-9-8-10-18(4-2)22(17)27-24(29)23(28)26-21-15-13-20(14-16-21)25-19-11-6-5-7-12-19/h5-16,25H,3-4H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | QSNPQCWFNNWGOI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|