C28H26N4O — CID 102428329
N-[4-[4-(4-anilinoanilino)anilino]phenyl]-2-methylprop-2-enamide (PubChem CID 102428329) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[4-[4-(4-anilinoanilino)anilino]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-(4-anilinoanilino)anilino]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 102428329 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-[4-[4-(4-anilinoanilino)anilino]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(Nc2ccc(Nc3ccc(Nc4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N4O/c1-20(2)28(33)32-27-18-16-26(17-19-27)31-25-14-12-24(13-15-25)30-23-10-8-22(9-11-23)29-21-6-4-3-5-7-21/h3-19,29-31H,1H2,2H3,(H,32,33) |
| InChIKey | BOXINIYTPCWYLJ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|