About methylboronic acid;2-methyl-N-phenylprop-2-enamide
methylboronic acid;2-methyl-N-phenylprop-2-enamide (PubChem CID 159528809) has the molecular formula C11H16BNO3
and a molecular weight of 221.06 g/mol. Its IUPAC name is methylboronic acid;2-methyl-N-phenylprop-2-enamide.
Molecular Properties
| Compound Name | methylboronic acid;2-methyl-N-phenylprop-2-enamide |
| PubChem CID | 159528809 |
| Molecular Formula | C11H16BNO3 |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | methylboronic acid;2-methyl-N-phenylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccccc1.CB(O)O |
| InChI | InChI=1S/C10H11NO.CH5BO2/c1-8(2)10(12)11-9-6-4-3-5-7-9;1-2(3)4/h3-7H,1H2,2H3,(H,11,12);3-4H,1H3 |
| InChIKey | MCSOFTUWZITALD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methylboronic acid;2-methyl-N-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylboronic acid;2-methyl-N-phenylprop-2-enamide?
The IUPAC name of methylboronic acid;2-methyl-N-phenylprop-2-enamide (CID 159528809) is methylboronic acid;2-methyl-N-phenylprop-2-enamide.
What is the SMILES notation for methylboronic acid;2-methyl-N-phenylprop-2-enamide?
The canonical SMILES for methylboronic acid;2-methyl-N-phenylprop-2-enamide is C=C(C)C(=O)Nc1ccccc1.CB(O)O.
What is the InChIKey of methylboronic acid;2-methyl-N-phenylprop-2-enamide?
The InChIKey is MCSOFTUWZITALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.CH5BO2/c1-8(2)10(12)11-9-6-4-3-5-7-9;1-2(3)4/h3-7H,1H2,2H3,(H,11,12);3-4H,1H3.
What are the key properties of methylboronic acid;2-methyl-N-phenylprop-2-enamide?
methylboronic acid;2-methyl-N-phenylprop-2-enamide has a molecular weight of 221.06 g/mol, XLogP of 1.29, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylboronic acid;2-methyl-N-phenylprop-2-enamide is sourced from PubChem (CID 159528809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).