C10H12BNO4 — CID 139688693
[4-(2-methylprop-2-enoylamino)phenoxy]boronic acid (PubChem CID 139688693) has the molecular formula C10H12BNO4 and a molecular weight of 221.02 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoylamino)phenoxy]boronic acid.
| Compound Name | [4-(2-methylprop-2-enoylamino)phenoxy]boronic acid |
|---|---|
| PubChem CID | 139688693 |
| Molecular Formula | C10H12BNO4 |
| Molecular Weight | 221.02 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | [4-(2-methylprop-2-enoylamino)phenoxy]boronic acid |
| SMILES | C=C(C)C(=O)Nc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C10H12BNO4/c1-7(2)10(13)12-8-3-5-9(6-4-8)16-11(14)15/h3-6,14-15H,1H2,2H3,(H,12,13) |
| InChIKey | RTAZNYLFRIDYPM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.02 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|