C30H30N3O6Sb — CID 172860369
tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite (PubChem CID 172860369) has the molecular formula C30H30N3O6Sb and a molecular weight of 650.34 g/mol. Its IUPAC name is tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite.
| Compound Name | tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite |
|---|---|
| PubChem CID | 172860369 |
| Molecular Formula | C30H30N3O6Sb |
| Molecular Weight | 650.34 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite |
| SMILES | C=C(C)C(=O)Nc1ccc(O[Sb](Oc2ccc(NC(=O)C(=C)C)cc2)Oc2ccc(NC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/3C10H11NO2.Sb/c3*1-7(2)10(13)11-8-3-5-9(12)6-4-8;/h3*3-6,12H,1H2,2H3,(H,11,13);/q;;;+3/p-3 |
| InChIKey | ZGPQAZMPOSFYRH-UHFFFAOYSA-K |
| XLogP | 5.75 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|