tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite

C30H30N3O6Sb — CID 172860369

IUPACtris[4-(2-methylprop-2-enoylamino)phenyl] stiborite
SMILESC=C(C)C(=O)Nc1ccc(O[Sb](Oc2ccc(NC(=O)C(=C)C)cc2)Oc2ccc(NC(=O)C(=C)C)cc2)cc1
InChIInChI=1S/3C10H11NO2.Sb/c3*1-7(2)10(13)11-8-3-5-9(12)6-4-8;/h3*3-6,12H,1H2,2H3,(H,11,13);/q;;;+3/p-3
InChIKeyZGPQAZMPOSFYRH-UHFFFAOYSA-K
MW650.34 g/mol
LogP5.75
Rot. Bonds12

About tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite

tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite (PubChem CID 172860369) has the molecular formula C30H30N3O6Sb and a molecular weight of 650.34 g/mol. Its IUPAC name is tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite.

Molecular Properties

Compound Nametris[4-(2-methylprop-2-enoylamino)phenyl] stiborite
PubChem CID172860369
Molecular FormulaC30H30N3O6Sb
Molecular Weight650.34 g/mol
Exact Mass649.12
IUPAC Nametris[4-(2-methylprop-2-enoylamino)phenyl] stiborite
SMILESC=C(C)C(=O)Nc1ccc(O[Sb](Oc2ccc(NC(=O)C(=C)C)cc2)Oc2ccc(NC(=O)C(=C)C)cc2)cc1
InChIInChI=1S/3C10H11NO2.Sb/c3*1-7(2)10(13)11-8-3-5-9(12)6-4-8;/h3*3-6,12H,1H2,2H3,(H,11,13);/q;;;+3/p-3
InChIKeyZGPQAZMPOSFYRH-UHFFFAOYSA-K
XLogP5.75
TPSA114.99 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds12
Heavy Atoms40
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500650.34
LogP ≤ 55.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite?
The IUPAC name of tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite (CID 172860369) is tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite.
What is the SMILES notation for tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite?
The canonical SMILES for tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite is C=C(C)C(=O)Nc1ccc(O[Sb](Oc2ccc(NC(=O)C(=C)C)cc2)Oc2ccc(NC(=O)C(=C)C)cc2)cc1.
What is the InChIKey of tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite?
The InChIKey is ZGPQAZMPOSFYRH-UHFFFAOYSA-K. The full InChI is InChI=1S/3C10H11NO2.Sb/c3*1-7(2)10(13)11-8-3-5-9(12)6-4-8;/h3*3-6,12H,1H2,2H3,(H,11,13);/q;;;+3/p-3.
What are the key properties of tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite?
tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite has a molecular weight of 650.34 g/mol, XLogP of 5.75, 12 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris[4-(2-methylprop-2-enoylamino)phenyl] stiborite is sourced from PubChem (CID 172860369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).