C11H13N2O5S2- — CID 101364771
[4-(2-methylprop-2-enoylamino)phenyl]sulfonyl-methylsulfonylazanide (PubChem CID 101364771) has the molecular formula C11H13N2O5S2- and a molecular weight of 317.37 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoylamino)phenyl]sulfonyl-methylsulfonylazanide.
| Compound Name | [4-(2-methylprop-2-enoylamino)phenyl]sulfonyl-methylsulfonylazanide |
|---|---|
| PubChem CID | 101364771 |
| Molecular Formula | C11H13N2O5S2- |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | [4-(2-methylprop-2-enoylamino)phenyl]sulfonyl-methylsulfonylazanide |
| SMILES | C=C(C)C(=O)Nc1ccc(S(=O)(=O)[N-]S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H13N2O5S2/c1-8(2)11(14)12-9-4-6-10(7-5-9)20(17,18)13-19(3,15)16/h4-7H,1H2,2-3H3,(H,12,14)/q-1 |
| InChIKey | LZUJLJJLKPYPKE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|