C12H15NO3S2 — CID 3633698
N-(4-ethylsulfanylsulfonylphenyl)-2-methylprop-2-enamide (PubChem CID 3633698) has the molecular formula C12H15NO3S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(4-ethylsulfanylsulfonylphenyl)-2-methylprop-2-enamide.
| Compound Name | N-(4-ethylsulfanylsulfonylphenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 3633698 |
| Molecular Formula | C12H15NO3S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-(4-ethylsulfanylsulfonylphenyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(S(=O)(=O)SCC)cc1 |
| InChI | InChI=1S/C12H15NO3S2/c1-4-17-18(15,16)11-7-5-10(6-8-11)13-12(14)9(2)3/h5-8H,2,4H2,1,3H3,(H,13,14) |
| InChIKey | GINMIFDUBVPSJM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|