C13H16N2O6S2 — CID 3507711
2-acetamido-3-(4-acetamidophenyl)sulfonylsulfanylpropanoic acid (PubChem CID 3507711) has the molecular formula C13H16N2O6S2 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-acetamido-3-(4-acetamidophenyl)sulfonylsulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(4-acetamidophenyl)sulfonylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 3507711 |
| Molecular Formula | C13H16N2O6S2 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-acetamido-3-(4-acetamidophenyl)sulfonylsulfanylpropanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)SCC(NC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H16N2O6S2/c1-8(16)14-10-3-5-11(6-4-10)23(20,21)22-7-12(13(18)19)15-9(2)17/h3-6,12H,7H2,1-2H3,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | PCQKLIJGTUJCAD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|