C12H15NO5S2 — CID 97035135
(2S)-2-acetamido-3-(4-methylphenyl)sulfonylsulfanylpropanoic acid (PubChem CID 97035135) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(4-methylphenyl)sulfonylsulfanylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-(4-methylphenyl)sulfonylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 97035135 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2S)-2-acetamido-3-(4-methylphenyl)sulfonylsulfanylpropanoic acid |
| SMILES | CC(=O)N[C@H](CSS(=O)(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C12H15NO5S2/c1-8-3-5-10(6-4-8)20(17,18)19-7-11(12(15)16)13-9(2)14/h3-6,11H,7H2,1-2H3,(H,13,14)(H,15,16)/t11-/m1/s1 |
| InChIKey | DTYDDEBFHLIKGG-LLVKDONJSA-N |
| XLogP | 1.01 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|