C15H20N2O5S2 — CID 58483068
2-acetamido-3-[[2-amino-3-(4-methylphenoxy)-3-oxopropyl]disulfanyl]propanoic acid (PubChem CID 58483068) has the molecular formula C15H20N2O5S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-acetamido-3-[[2-amino-3-(4-methylphenoxy)-3-oxopropyl]disulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[2-amino-3-(4-methylphenoxy)-3-oxopropyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 58483068 |
| Molecular Formula | C15H20N2O5S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-acetamido-3-[[2-amino-3-(4-methylphenoxy)-3-oxopropyl]disulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSSCC(N)C(=O)Oc1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C15H20N2O5S2/c1-9-3-5-11(6-4-9)22-15(21)12(16)7-23-24-8-13(14(19)20)17-10(2)18/h3-6,12-13H,7-8,16H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | POHSQMGLZFJCOS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|