C28H36N4O10S2+2 — CID 58429817
[2-[4-[2-acetamido-3-[[2-acetamido-3-[4-(2-azaniumyl-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-1-carboxyethyl]azanium (PubChem CID 58429817) has the molecular formula C28H36N4O10S2+2 and a molecular weight of 652.75 g/mol. Its IUPAC name is [2-[4-[2-acetamido-3-[[2-acetamido-3-[4-(2-azaniumyl-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-1-carboxyethyl]azanium.
| Compound Name | [2-[4-[2-acetamido-3-[[2-acetamido-3-[4-(2-azaniumyl-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-1-carboxyethyl]azanium |
|---|---|
| PubChem CID | 58429817 |
| Molecular Formula | C28H36N4O10S2+2 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.19 |
| IUPAC Name | [2-[4-[2-acetamido-3-[[2-acetamido-3-[4-(2-azaniumyl-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-1-carboxyethyl]azanium |
| SMILES | CC(=O)NC(CSSCC(NC(C)=O)C(=O)Oc1ccc(CC([NH3+])C(=O)O)cc1)C(=O)Oc1ccc(CC([NH3+])C(=O)O)cc1 |
| InChI | InChI=1S/C28H34N4O10S2/c1-15(33)31-23(27(39)41-19-7-3-17(4-8-19)11-21(29)25(35)36)13-43-44-14-24(32-16(2)34)28(40)42-20-9-5-18(6-10-20)12-22(30)26(37)38/h3-10,21-24H,11-14,29-30H2,1-2H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38)/p+2 |
| InChIKey | JHFTVAUGHIRULB-UHFFFAOYSA-P |
| XLogP | -0.94 |
| TPSA | 240.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|