C28H34N4O10S2 — CID 53380840
3-[4-[2-acetamido-3-[[2-acetamido-3-[3-(2-amino-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-2-aminopropanoic acid (PubChem CID 53380840) has the molecular formula C28H34N4O10S2 and a molecular weight of 650.73 g/mol. Its IUPAC name is 3-[4-[2-acetamido-3-[[2-acetamido-3-[3-(2-amino-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-2-aminopropanoic acid.
| Compound Name | 3-[4-[2-acetamido-3-[[2-acetamido-3-[3-(2-amino-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-2-aminopropanoic acid |
|---|---|
| PubChem CID | 53380840 |
| Molecular Formula | C28H34N4O10S2 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.17 |
| IUPAC Name | 3-[4-[2-acetamido-3-[[2-acetamido-3-[3-(2-amino-2-carboxyethyl)phenoxy]-3-oxopropyl]disulfanyl]propanoyl]oxyphenyl]-2-aminopropanoic acid |
| SMILES | CC(=O)NC(CSSCC(NC(C)=O)C(=O)Oc1cccc(CC(N)C(=O)O)c1)C(=O)Oc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C28H34N4O10S2/c1-15(33)31-23(27(39)41-19-8-6-17(7-9-19)11-21(29)25(35)36)13-43-44-14-24(32-16(2)34)28(40)42-20-5-3-4-18(10-20)12-22(30)26(37)38/h3-10,21-24H,11-14,29-30H2,1-2H3,(H,31,33)(H,32,34)(H,35,36)(H,37,38) |
| InChIKey | PUMLKWUFEHSFGX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 237.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|