C18H20N2O4 — CID 129143949
2-amino-3-[3-(2-amino-3-phenylpropanoyl)oxyphenyl]propanoic acid (PubChem CID 129143949) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-amino-3-[3-(2-amino-3-phenylpropanoyl)oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-(2-amino-3-phenylpropanoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 129143949 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-amino-3-[3-(2-amino-3-phenylpropanoyl)oxyphenyl]propanoic acid |
| SMILES | NC(Cc1cccc(OC(=O)C(N)Cc2ccccc2)c1)C(=O)O |
| InChI | InChI=1S/C18H20N2O4/c19-15(17(21)22)11-13-7-4-8-14(9-13)24-18(23)16(20)10-12-5-2-1-3-6-12/h1-9,15-16H,10-11,19-20H2,(H,21,22) |
| InChIKey | YTGUYWFZSILMMS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|