C15H13Cl2NO3 — CID 70117929
(2R)-2-amino-3-[3-(3,4-dichlorophenoxy)phenyl]propanoic acid (PubChem CID 70117929) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is (2R)-2-amino-3-[3-(3,4-dichlorophenoxy)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[3-(3,4-dichlorophenoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70117929 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (2R)-2-amino-3-[3-(3,4-dichlorophenoxy)phenyl]propanoic acid |
| SMILES | N[C@H](Cc1cccc(Oc2ccc(Cl)c(Cl)c2)c1)C(=O)O |
| InChI | InChI=1S/C15H13Cl2NO3/c16-12-5-4-11(8-13(12)17)21-10-3-1-2-9(6-10)7-14(18)15(19)20/h1-6,8,14H,7,18H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | XPGSTJCNNKKIIX-CQSZACIVSA-N |
| XLogP | 3.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |