C12H15Cl2NO3 — CID 118195784
2-amino-3-[3-(2,3-dichloropropoxy)phenyl]propanoic acid (PubChem CID 118195784) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 2-amino-3-[3-(2,3-dichloropropoxy)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[3-(2,3-dichloropropoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 118195784 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-amino-3-[3-(2,3-dichloropropoxy)phenyl]propanoic acid |
| SMILES | NC(Cc1cccc(OCC(Cl)CCl)c1)C(=O)O |
| InChI | InChI=1S/C12H15Cl2NO3/c13-6-9(14)7-18-10-3-1-2-8(4-10)5-11(15)12(16)17/h1-4,9,11H,5-7,15H2,(H,16,17) |
| InChIKey | BVWLQTIRTYJUEF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|