C21H21NO3 — CID 69316412
(2S)-2-amino-3-[3-(2-naphthalen-2-ylethoxy)phenyl]propanoic acid (PubChem CID 69316412) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(2-naphthalen-2-ylethoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(2-naphthalen-2-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 69316412 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2S)-2-amino-3-[3-(2-naphthalen-2-ylethoxy)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1cccc(OCCc2ccc3ccccc3c2)c1)C(=O)O |
| InChI | InChI=1S/C21H21NO3/c22-20(21(23)24)14-16-4-3-7-19(13-16)25-11-10-15-8-9-17-5-1-2-6-18(17)12-15/h1-9,12-13,20H,10-11,14,22H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | PNGGNXAPDSHHCA-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |