C20H18ClNO4 — CID 10215748
2-amino-3-[4-chloro-3-(6-methoxynaphthalen-2-yl)oxyphenyl]propanoic acid (PubChem CID 10215748) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-amino-3-[4-chloro-3-(6-methoxynaphthalen-2-yl)oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-chloro-3-(6-methoxynaphthalen-2-yl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 10215748 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-amino-3-[4-chloro-3-(6-methoxynaphthalen-2-yl)oxyphenyl]propanoic acid |
| SMILES | COc1ccc2cc(Oc3cc(CC(N)C(=O)O)ccc3Cl)ccc2c1 |
| InChI | InChI=1S/C20H18ClNO4/c1-25-15-5-3-14-11-16(6-4-13(14)10-15)26-19-9-12(2-7-17(19)21)8-18(22)20(23)24/h2-7,9-11,18H,8,22H2,1H3,(H,23,24) |
| InChIKey | ZGGWJDZLKXOTHV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |