C17H19NO3 — CID 67243066
(2S)-2-amino-3-[4-(4-methoxy-2-methylphenyl)phenyl]propanoic acid (PubChem CID 67243066) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(4-methoxy-2-methylphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(4-methoxy-2-methylphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 67243066 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2S)-2-amino-3-[4-(4-methoxy-2-methylphenyl)phenyl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(C[C@H](N)C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C17H19NO3/c1-11-9-14(21-2)7-8-15(11)13-5-3-12(4-6-13)10-16(18)17(19)20/h3-9,16H,10,18H2,1-2H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | JEDSIOLFVAZSFT-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |