C15H17NO3 — CID 171238349
methyl (2S)-2-amino-3-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 171238349) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 171238349 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (2S)-2-amino-3-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-18-13-6-5-11-7-10(3-4-12(11)9-13)8-14(16)15(17)19-2/h3-7,9,14H,8,16H2,1-2H3/t14-/m0/s1 |
| InChIKey | HLZFDRDDBOHKJQ-AWEZNQCLSA-N |
| XLogP | 1.89 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |