C14H16ClNO3 — CID 54768230
methyl 2-amino-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride (PubChem CID 54768230) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is methyl 2-amino-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 54768230 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | methyl 2-amino-3-(6-hydroxynaphthalen-2-yl)propanoate;hydrochloride |
| SMILES | COC(=O)C(N)Cc1ccc2cc(O)ccc2c1.Cl |
| InChI | InChI=1S/C14H15NO3.ClH/c1-18-14(17)13(15)7-9-2-3-11-8-12(16)5-4-10(11)6-9;/h2-6,8,13,16H,7,15H2,1H3;1H |
| InChIKey | JFMGXCIOKRVQQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |