C12H15N3O3S — CID 4686080
2-acetamido-3-[(4-methylphenyl)diazenyl]sulfanylpropanoic acid (PubChem CID 4686080) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-acetamido-3-[(4-methylphenyl)diazenyl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[(4-methylphenyl)diazenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 4686080 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-acetamido-3-[(4-methylphenyl)diazenyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CS/N=N/c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C12H15N3O3S/c1-8-3-5-10(6-4-8)14-15-19-7-11(12(17)18)13-9(2)16/h3-6,11H,7H2,1-2H3,(H,13,16)(H,17,18)/b15-14+ |
| InChIKey | DXCZQHVBZLKTTE-CCEZHUSRSA-N |
| XLogP | 2.32 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|