C12H15N7O5S — CID 3555222
2-acetamido-3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)diazenyl]sulfanylpropanoic acid (PubChem CID 3555222) has the molecular formula C12H15N7O5S and a molecular weight of 369.36 g/mol. Its IUPAC name is 2-acetamido-3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)diazenyl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)diazenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 3555222 |
| Molecular Formula | C12H15N7O5S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-acetamido-3-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)diazenyl]sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSN=Nc1nc2c([nH]1)c(=O)n(C)c(=O)n2C)C(=O)O |
| InChI | InChI=1S/C12H15N7O5S/c1-5(20)13-6(10(22)23)4-25-17-16-11-14-7-8(15-11)18(2)12(24)19(3)9(7)21/h6H,4H2,1-3H3,(H,13,20)(H,14,15)(H,22,23) |
| InChIKey | NIPFJIBKHAZCFO-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|