C10H10N4O4 — CID 90403855
(E)-3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)prop-2-enoic acid (PubChem CID 90403855) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is (E)-3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 90403855 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (E)-3-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)prop-2-enoic acid |
| SMILES | Cn1c(=O)c2[nH]c(/C=C/C(=O)O)nc2n(C)c1=O |
| InChI | InChI=1S/C10H10N4O4/c1-13-8-7(9(17)14(2)10(13)18)11-5(12-8)3-4-6(15)16/h3-4H,1-2H3,(H,11,12)(H,15,16)/b4-3+ |
| InChIKey | MMNHXLFDONPVOX-ONEGZZNKSA-N |
| XLogP | -0.94 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|