C7H9N6O2+ — CID 137270785
(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)iminoazanium (PubChem CID 137270785) has the molecular formula C7H9N6O2+ and a molecular weight of 209.19 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)iminoazanium.
| Compound Name | (1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)iminoazanium |
|---|---|
| PubChem CID | 137270785 |
| Molecular Formula | C7H9N6O2+ |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)iminoazanium |
| SMILES | Cn1c(=O)c2[nH]c(N=[NH2+])nc2n(C)c1=O |
| InChI | InChI=1S/C7H8N6O2/c1-12-4-3(9-6(10-4)11-8)5(14)13(2)7(12)15/h8H,1-2H3,(H,9,10)/p+1 |
| InChIKey | WAXDIPJGVKVRIT-UHFFFAOYSA-O |
| XLogP | -2.20 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|