C12H19N5O2 — CID 61167628
8-(2,2-dimethylpropylamino)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 61167628) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-(2,2-dimethylpropylamino)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(2,2-dimethylpropylamino)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 61167628 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 8-(2,2-dimethylpropylamino)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NCC(C)(C)C)nc2n(C)c1=O |
| InChI | InChI=1S/C12H19N5O2/c1-12(2,3)6-13-10-14-7-8(15-10)16(4)11(19)17(5)9(7)18/h6H2,1-5H3,(H2,13,14,15) |
| InChIKey | QTFZJCMPKIAVRJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |