About Aminophylline
Aminophylline (PubChem CID 9433) has the molecular formula C16H24N10O4
and a molecular weight of 420.43 g/mol. Its IUPAC name is bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine.
Molecular Properties
| Compound Name | Aminophylline |
| PubChem CID | 9433 |
| Molecular Formula | C16H24N10O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N |
| InChI | InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
| InChIKey | FQPFAHBPWDRTLU-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 191.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | 273 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Aminophylline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Aminophylline?
The IUPAC name of Aminophylline (CID 9433) is bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine.
What is the SMILES notation for Aminophylline?
The canonical SMILES for Aminophylline is CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N.
What is the InChIKey of Aminophylline?
The InChIKey is FQPFAHBPWDRTLU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2.
What are the key properties of Aminophylline?
Aminophylline has a molecular weight of 420.43 g/mol, XLogP of not available, 1 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Aminophylline is sourced from PubChem (CID 9433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).