C16H24N10O4 — CID 9433
bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine (PubChem CID 9433) has the molecular formula C16H24N10O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine.
| Compound Name | bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine |
|---|---|
| PubChem CID | 9433 |
| Molecular Formula | C16H24N10O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | bis(1,3-dimethyl-7H-purine-2,6-dione);ethane-1,2-diamine |
| SMILES | Cn1c(=O)c2[nH]cnc2n(C)c1=O.Cn1c(=O)c2[nH]cnc2n(C)c1=O.NCCN |
| InChI | InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
| InChIKey | FQPFAHBPWDRTLU-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 197.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |