C9H12N5NaO4 — CID 23663537
sodium;2-aminoacetate;1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 23663537) has the molecular formula C9H12N5NaO4 and a molecular weight of 277.22 g/mol. Its IUPAC name is sodium;2-aminoacetate;1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | sodium;2-aminoacetate;1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 23663537 |
| Molecular Formula | C9H12N5NaO4 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | sodium;2-aminoacetate;1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]cnc2n(C)c1=O.NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H8N4O2.C2H5NO2.Na/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2(4)5;/h3H,1-2H3,(H,8,9);1,3H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | AIJQWRAOMFRHTQ-UHFFFAOYSA-M |
| XLogP | -6.34 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |