About 3-Methylxanthine
3-Methylxanthine (PubChem CID 70639) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 3-methyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 3-Methylxanthine |
| PubChem CID | 70639 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3-methyl-7H-purine-2,6-dione |
| SMILES | CN1C2=C(C(=O)NC1=O)NC=N2 |
| InChI | InChI=1S/C6H6N4O2/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2H,1H3,(H,7,8)(H,9,11,12) |
| InChIKey | GMSNIKWWOQHZGF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 242 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-Methylxanthine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methylxanthine?
The IUPAC name of 3-Methylxanthine (CID 70639) is 3-methyl-7H-purine-2,6-dione.
What is the SMILES notation for 3-Methylxanthine?
The canonical SMILES for 3-Methylxanthine is CN1C2=C(C(=O)NC1=O)NC=N2.
What is the InChIKey of 3-Methylxanthine?
The InChIKey is GMSNIKWWOQHZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c1-10-4-3(7-2-8-4)5(11)9-6(10)12/h2H,1H3,(H,7,8)(H,9,11,12).
What are the key properties of 3-Methylxanthine?
3-Methylxanthine has a molecular weight of 166.14 g/mol, XLogP of -0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methylxanthine is sourced from PubChem (CID 70639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).