About Xanthine
Xanthine (PubChem CID 1188) has the molecular formula C5H4N4O2
and a molecular weight of 152.11 g/mol. Its IUPAC name is 3,7-dihydropurine-2,6-dione.
Molecular Properties
| Compound Name | Xanthine |
| PubChem CID | 1188 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 3,7-dihydropurine-2,6-dione |
| SMILES | C1=NC2=C(N1)C(=O)NC(=O)N2 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 217 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Xanthine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Xanthine?
The IUPAC name of Xanthine (CID 1188) is 3,7-dihydropurine-2,6-dione.
What is the SMILES notation for Xanthine?
The canonical SMILES for Xanthine is C1=NC2=C(N1)C(=O)NC(=O)N2.
What is the InChIKey of Xanthine?
The InChIKey is LRFVTYWOQMYALW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11).
What are the key properties of Xanthine?
Xanthine has a molecular weight of 152.11 g/mol, XLogP of -0.70, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Xanthine is sourced from PubChem (CID 1188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).