C5H4N4O2 — CID 1188
3,7-dihydropurine-2,6-dione (PubChem CID 1188) has the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. Its IUPAC name is 3,7-dihydropurine-2,6-dione.
| Compound Name | 3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 1188 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1 |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | LRFVTYWOQMYALW-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |