About 8-chloro-1,3-dimethyl-7H-purine-2,6-dione
8-chloro-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 10661) has the molecular formula C7H7ClN4O2
and a molecular weight of 214.61 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-chloro-1,3-dimethyl-7H-purine-2,6-dione |
| PubChem CID | 10661 |
| Molecular Formula | C7H7ClN4O2 |
| Molecular Weight | 214.61 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| InChIKey | RYIGNEOBDRVTHA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.61 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-1,3-dimethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1,3-dimethyl-7H-purine-2,6-dione?
The IUPAC name of 8-chloro-1,3-dimethyl-7H-purine-2,6-dione (CID 10661) is 8-chloro-1,3-dimethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-chloro-1,3-dimethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-chloro-1,3-dimethyl-7H-purine-2,6-dione is Cn1c(=O)c2[nH]c(Cl)nc2n(C)c1=O.
What is the InChIKey of 8-chloro-1,3-dimethyl-7H-purine-2,6-dione?
The InChIKey is RYIGNEOBDRVTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10).
What are the key properties of 8-chloro-1,3-dimethyl-7H-purine-2,6-dione?
8-chloro-1,3-dimethyl-7H-purine-2,6-dione has a molecular weight of 214.61 g/mol, XLogP of -0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1,3-dimethyl-7H-purine-2,6-dione is sourced from PubChem (CID 10661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).